Synonyms: (CID 3672) Total: 1045        Display:       
ibuprofen      
Motrin      
Brufen      
Dolgit
Liptan
Nuprin      
Advil
Butylenin
Ibuprocin
Anflagen
Buburone
Ibumetin      
Medipren
Lamidon
Nurofen
Ebufac
Rufen      
Mynosedin
Roidenin
Apsifen
Brufort
Epobron
Haltran
Inabrin
Suspren
Tabalon
Trendar
Bluton
Nobfen
Nobgen
PediaProfen
Adran
Anco
Urem
Andran
Amibufen
Dolgirid
Ibuprohm
Lebrufen
Nobfelon
Seclodin
Amersol
Femadon
Pantrop
Rebugen
Ibutid
Inoven
Ibren
Betaprofen
Ibuprophen
Novoprofen
Ibu-Attritin
Kratalgin
Napacetin
Neobrufen
Solpaflex
Brufanic
Dolofort
Dolormin
Ibugesic
Ibuhexal
Artofen
Dolo-Dolgit
Dolocyl
Dorival
Ibuleve
Ibuprin
Lidifen
Panafen
Paxofen
Alaxan
Burana
Dolgin
Fenbid
Ibufen
Ibugel
Narfen
Profen
Cap-Profen
Dalsy
Ipren
Midol
Rafen
Upfen
Ibu-slo
Ifen
duralbuprofen
Balkaprofen
Actiprofen
Antalfene
Combiflam
Daiprophen
Dignoflex
Femapirin
Fibraflex
Ibuflamar
Ibuprofene
Jenaprofen
Proartinal
Rhinadvil
Salprofen      
Syntofene
Antarene
Antiflam
Bukrefen
Buracaps
Caldolor
Citalgan
Dentigoa
Dolmaral
Doltibil
Dysdolen
Esprenit
Exneural
Gelufene
Ibucasen
Ibudolor
Ibulagic
Ibumerck
Ibupirac
Librofem
Malafene
Manypren
Mensoton
Novogent
Nuprilan
Oralfene
Relcofen
Sednafen
Seklodin
Seskafen
Spedifen
Suprafen
Algofen
Amelior
Antagil
Bruflam
Bufigen
Dansida
Dibufen
Dolofen
Dolofin
Dologel
Dolomax
Doloren
Duobrus
Easifon
Femafen
Femidol
Fenspan
Gynofug
Ibubest
Ibubeta
Ibulgan
Junifen
Nerofen
Noalgil
Nobafon
Noritis
Novadol
Optifen
Opturem
Ostarin
Ostofen
Paduden
Perofen
Proflex
Quadrax
Ranofen
Sadefen
Salivia
Siyafen
Solufen
Sugafen
Tatanal
Unipron
Uprofen
Tab-Profen
Anafen
Artril
Brofen
Bufeno
Bupron
Dolibu
Dolven
Duafen
Emflam
Eputex
Faspic
Fendol
Grefen
Ibudol
Ibufug
Ibugen
Ibular
Ibulav
Ibumed
Ibusal
Inflam
Isodol
Lopane
Melfen
Moment
Norton
Ozonol
Provon
Stelar
Tempil
Bloom
Carol
Cesra
Cunil
Ergix
Gofen
Irfen
Kesan
Rofen
Rufin
Rupan
Tofen
Tonal
Zafen
Zofen
(RS)-Ibuprofen
Cobo
Drin
Ibol
2-(4-Isobutylphenyl)propanoic acid
Children's Advil
Pediatric Advil
Apo-Ibuprofen
Brufen Retard
Ibu-Tab
Neo-Helvagit
Butacortelone
Children's Motrin
Deep Relief
Dularbuprofen
Novo-Profen
Ibu-slow
Ibuprofeno
Ibuprofenum
Combunox
Neo-Mindol
Neoprofen
Genpril
Ibuprox
Aktren
Codral
(+-)-Ibuprofen
Apsifen-F
Dolofen-F
Donjust B
Nagifen-D
Dura-Ibu
Kontagripp Mono
Motrin IB
Advil Liqui-Gels
Ibuprofen-Zinc
Schmerz-Dolgit
Dristan Sinus
Novo Dioxadol
Togal N
Ibuprofen sodium
Pedia-Profen
ibuprofin
ibuprophene
Children's Ibuprofen
p-Isobutylhydratropic acid
Novogent N
Nurofenreg
Ratiodolor
Vicoprofen
Advilreg
Algoflex
Algofren
Arthrofen
Betagesic
Brufenreg
Buprovil
Calprofen
Dismenol
Espidifen
Finalflex
Galprofen
Ibumidol
Ibuprosyn
Motrinreg
Myprodol
Norvectan
Nureflex
Salvarina
Spidifen
Alivium
Bonifen
Bugesic
Diverin
Doloraz
Fenpaed
Ibalgin
Ibuflam
Ibupain
Ibuprom
Ibustar
Medicol
Orbifen
Perifar
Rapidol
Rimafen
Hemagene Tailleur
Ibumax
ibuprofen-lysin
ibuprofenarginat
ibuprofenlysinat
Ibuxin
Mypaid
Profin
Ranfen
Unafen
water-ibuprofen
anti-ibuprofen
ibuprofen hplc
ibuprofen rac
rac-ibuprofen
(+/-)-Ibuprofen
dl-ibuprofen
ibuprofen arginate
ibuprofen arginine
Lotem
Pedea
rs-ibuprofen
Tefin
Children's Elixsure
EmuProfen
ibuprofen-l
Junior Strength Advil
l ibuprofen
/ibuprofen
Adex
Advil migraine
Artril 300
Ibum
Ibup
ibuprofen,
Ibux
carbon-ibuprofen
copper-ibuprofen
Fenbid Spansule
i-profen
ibuprofen eiuted
ibuprofen hexane
ibuprofen joaded
ibuprofen-copper
ibuprofen-kalium
ibuprofen-lysine
ibuprofen-sodium
ibuprofen/copper
ibuprofen/silver
ibuprofen/sodium
ibuprofenarginine
lysine ibuprofen
Ibuprofen Zinc
Dolo-Spedifen
Junior Strength Motrin
Mixture Name
Sodium ibuprofen
Trauma-Dolgit Gel
cm) ibuprofen
ibuprofen d,l
kg) ibuprofen
a) ibuprofen
Act-3
Anadin Ibuprofen
b) ibuprofen
CDT-ibuprofen
d -ibuprofen
d) ibuprofen
h) ibuprofen
Herron Blue
Ibu-Vivimed
ibuprofen USP
Nurofen Meltlets
Tabalon 400
aspirin ibuprofen
aspirin/ibuprofen
calcium ibuprofen
ibuprofen acetate
ibuprofen calcium
ibuprofen hydrate
ibuprofen impoved
ibuprofen,natural
ibuprofen-aspirin
ibuprofen-calcium
ibuprofen-lysinat
ibuprofen-natrium
ibuprofen/aspirin
Midol 200
Motrin IB Gelcaps
natrium-ibuprofen
racemic-ibuprofen
[ibuprofen]
Advil, Children's
IBU-Ratiopharm
R-ibuprofen-Arg
Codral Period Pain
Perrigo ibuprofen
Racemic~ibuprofen
TraumaDolgit Gel
Naron Ace
(iv) ibuprofen
Brufen 400
Emflam-200
Speedpain NANO
arginate ibuprofen
arginine/ibuprofen
ibuprofen,nicotine
ibuprofen-arginate
ibuprofen-arginine
ibuprofen-lysinate
lysinate ibuprofen
taurine-ibuprophen
(+-)-Ibuprophen
(a) ibuprofen
(b) ibuprofen
(e) ibuprofen
(i) ibuprofen
(m) ibuprofen
4-Isobutylhydratropic acid
Ibu-Tab 200
ibuprofen -copper
ibuprofen--copper
DOLO PUREN
Ibuprofen lysinate
w/w) Ibuprofen
()-ibuprofen
(-)ibuprofen
Alges-X
ibuprofen (N)
IBUPROFEN LYSINE
Motrin (TN)
(w/w) ibuprofen
ibuprofen -aspirin
ibuprofen l-lysine
ibuprofen,-aspirin
ibuprofen-l-serine
Junior Strength Ibuprofen
l-lysine ibuprofen
(nsaid) ibuprofen
Ak+C2278tren
aluminium ibuprofen
ibuprofen aluminium
ibuprofen dihydrate
ibuprofen ethanoate
ibuprofen ibuprofen
ibuprofen succinate
ibuprofen-aluminium
ibuprofen-potassium
ibuprofen/magnesium
ibuprofen/potassium
ibuprofendl-lysinat
potassium ibuprofen
potassium/ibuprofen
ruthenium-ibuprofen
(?-Ibuprofen
19b, ibuprofen
Anadin Joint Pain
Copper ibuprofenate
s(+) ibuprofen
Trauma Dolgit Gel
ACHES-N-PAIN
ibuprofen usp 10
(+) ibuprofen
(-) ibuprofen
(1) ibuprofen
(2) ibuprofen
Advil (TN)
Advil Cold & Sinus
Strontium Ibuprofen
(nsaids) ibuprofen
gabapentin/ibuprofen
ibuprofen -arginine
R(-) ibuprofen
Sine-Aid IB Caplets
(wt/wt) ibuprofen
d-(+)-ibuprofen
(+)-Ibuprofen
(?)-Ibuprofen
S () Ibuprofen
celecoxib) ibuprofen
ibuprofen /ibuprofen
ibuprofen l-lysinate
((rs)-ibuprofen)
(+/-)ibuprofen
(+/-)ibuprofin
(-) -ibuprofen
(wt/vol) ibuprofen
Adex 200
ibuprofen histidinate
Zinc Salt Ibuprofen
15687-27-1
Midol IB Cramp Relief
DEXIBUPROFEN
ibuprofen [brufen ]
ibuprofen [motrin ]
ibuprofen crsytallized
ibuprofen l-threonine
ibuprofen lysine salt
ibuprofen pre-blended
ibuprofen spray-dried
ibuprofen,nicotinamide
ibuprofen-nicotinamide
ibuprofen/salicylamide
Am-Fam 400
Children's Elixsure IB
Ibuprofen sodium salt
ibuprofen [10 m]
p-Isobutylhydratropate
ibuprofen d,1-lysine
ibuprofen lysine-based
ibuprofen-(s)-lysine
( (rs)-ibuprofen)
ibuprofen characterised
Ibuprofen, Zinc Salt
Salt Ibuprofen, Zinc
Sodium Salt Ibuprofen
S1638_Selleck
(iv) ibuprofen lysine
2-[4-(2-methylpropyl)phenyl]propanoic acid
AC1L1GGE
Bayer Select Pain Relief
Calcium Salt Ibuprofen
ibuprofen ammonium salt
ibuprofen glass-forming
Ibuprofen I.V. Solution
ibuprofen lysinate salt
ibuprofen lysine.1,2
ibuprofen-propargylamine
Ibuprofene [INN-French]
Ibuprofenum [INN-Latin]
1960's, ibuprofen
PubChem16054
()-ibuprofen-l-serine
Aluminum Salt Ibuprofen
CHEBI:5855
ibuprofen d,1-lysinate
Ibuprofen, Sodium Salt
Salt Ibuprofen, Sodium
Spectrum_000849
ibuprofen lysinate-based
ibuprofen potassium salt
ibuprofen self-poisoning
ibuprofen,nicotinic acid
ibuprofen-natrium-hydrat
Ibuprofeno [INN-Spanish]
sodium ibuprofen hydrate
ibuprofen glucopyranoside
ibuprofen microemulsified
ibuprofen radiosensitized
Ibuprofen sodium hydrate
ibuprofen-ethylenediamine
SINE-AID IB
CHEMBL521
ibuprofen co-spray-dried
Ibuprofen, Calcium Salt
ibuprofen hydrogen-bonded
Ibuprofen, (R)-Isomer
Ibuprofen, (S)-Isomer
ibuprofen,n-acetylcystein
ibuprofen-piperazine salt
IP-82      
Magnesium Salt Ibuprofen
MOTRIN MIGRAINE PAIN
Potassium Salt Ibuprofen
proprionic acid ibuprofen
(2) ibuprofen/ibuprofen
Hydratropic acid, p-isobutyl-
IBUPROFEN ALUMINUM
(5r)-(+)-ibuprofen
ibuprofen (taste-masked)
Ibuprofen, Aluminum Salt
ibuprofen/sba-spray-dried
(+-)-p-Isobutylhydratropic acid
ADVIL COLD AND SINUS
DSSTox_CID_732
ibuprofen (7.5-/kg)
ibuprofen sodium dihydrate
ibuprofen,n-acetylcysteine
ibuprofen-l-hydroxyproline
ibuprofen-natrium-dihydrat
ibuprofen-sodium dihydrate
ibuprofen/copper/tungstate
sodium ibuprofen dihydrate
Spectrum2_000129
Spectrum3_000465
Spectrum4_000015
Spectrum5_000862
UNII-WK2XYI10QM
(R) (-) -ibuprofen
4-Isobutyl-alpha-methylphenylacetic acid
CCRIS 3223
ibuprofen (rac-ibuprofen)
IBUPROFEN POTASSIUM
alpha-(4-Isobutylphenyl)propionic acid
Ibuprofen, Magnesium Salt
Ibuprofen, Potassium Salt
Para-Isobutylhydratropic Acid
Salt Ibuprofen, Magnesium
WLN: QVY&R DIY
Advil Migraine Liqui-Gels
CBMicro_005634
ibuprofen-irinotecan-loaded
ibuprofen d,1-lysine salt
ibuprofen isobutanolammonium
ibuprofen methanesulfonamide
IBUPROFEN USP GRADE
Ibuprofen, (+-)-Isomer
spray-dried ibuprofen/sba-
/sodium ibuprofen dihydrate
ACMC-209df0
ACMC-209ks2
ARONIS23835
BIDD:GT0050
Epitope ID:139973
I.V. Solution, Ibuprofen
I4883_SIGMA
ibuprofen -ibuprofen-kalium
ibuprofen,n-acetyl cysteine
p-isobutyl-hydratropic acid
sodium ibuprofen di-hydrate
alpha-p-Isobutylphenylpropionic acid
aluminum hydroxide-ibuprofen
HSDB 3099
ibuprofen (dl lysine salt)
ibuprofen sodium monohydrate
ibuprofen-aluminum hydroxide
SPBio_000178
VUFB 9649
2-(4-Isobutyl-phenyl)-propionic acid
ibuprofen (antiinflammatory)
ibuprofen (s)-(+)-based
ibuprofen sodium salt-loaded
MLS000069733
MLS001146965
SCHEMBL3001
(+/-)-ibuprofen-l-serine
AC1Q1P84
AC1Q1P85
glucosamine sulfate/ibuprofen
I7905_SIAL
ibuprofen fast-disintegrating
ibuprofen-potassium ibuprofen
ibuprofen/potassium ibuprofen
IP82      
p-Isobutyl-2-phenylpropionic acid
DSSTox_RID_75759
DSSTox_GSID_20732
GM. (2000) Ibuprofen
Lopac0_000691
2-(p-Isobutylphenyl)propionic acid
acetylsalicylic acid ibuprofen
BSPBio_002170
CHILDREN'S ADVIL COLD
Ibuprofen - Adooq Bioscience
ibuprofen methylglucamine salt
ibuprofen solubility-improving
ibuprofen-glycerol mononitrate
KBioGR_000389
KBioSS_001329
CHILDREN'S ADVIL-FLAVORED
HMS502M09
ibuprofen(75 ppm)/ce-sorb6
KBio1_000887
KBio2_001329
KBio2_003897
KBio2_006465
KBio3_001390
KSC492A1B
p-Isobutyl-2-phenylpropionate
()-ibuprofen-l-hydroxyproline
CHILDREN'S MOTRIN COLD
DivK1c_000887
SPECTRUM1500347
()-ibuprofen-1-hydroxyproline
CID3672
ibuprofen sodium salt dihydrate
ibuprofen,n-methyl-d-aspartate
NINDS_000887
IB-100
Ibuprofen (JP16/USP/INN)
IBUPROHM COLD AND SINUS
NSC256857
UCB 79171
2-(4-isobutylphenyl)propanoate
2-(4-isobutylphenyl)propionate
alpha-p-Isobutylphenylpropionate
BB_SC-1358
GTPL2713
HMS1920F15
HMS2089P05
HMS2091N03
ibuprofen(150 ppm)/ce-sorb6
ibuprofen(300 ppm)/ce-sorb6
Ibuprofen, Copper (2+) Salt
IP 82      
alpha-(p-isobutylphenyl)propionic acid
2-(p-isobutylphenyl) propionate
2-p-isobutylphenylpropionic acid
AGN-PC-008U46
C13H18O2
NSC 256857
(+-)-2-(p-Isobutylphenyl)propionic acid
2-(4-isobutyl-phenyl)propionate
2-(4-isobutylphenyl) propanoate
2-(4-isobutylphenyl) propionate
2-(4-isobutylphenyl)-propionate
CTK3J2010
EINECS 239-784-6
HEFNNWSXXWATRW-UHFFFAOYSA-
HMDB01925
ibuprofen, 3-hydroxybutyric acid
(4-Isobutylphenyl)-alpha-methylacetic acid
2-(4'-isobutylphenyl)propionic acid
2-(4-isobutylphenyl) propionic acid
2-(4-isobutylphenyl)-propionic acid
2-(4-ISOBUTYLPHENYL)PROPIONIC ACID
BRN 2049713
ibuprofen [15687-27-1]
2-(4isobutylphenyl)propanoic acid
alpha-p-isobutylphenylpropionicacid
HEFNNWSXXWATRW-UHFFFAOYSA-N
Ibuprofen [USAN:BAN:INN:JAN]
ibuprofen o-benzyl hydroxamic acid
STK177358
(+/-)-ibuprofen-l-hydroxyproline
2-(4 isobutyl-phenyl)-propionate
2-(4-isobutylphenyl)-propionoic acid
2-(4-isobutylphenyl)-propionsaure
alpha-(4-Isobutylphenyl)propionate
HMS2230N04
HMS3259G05
HMS3262K03
HMS3372M09
Pharmakon1600-01500347
RD 13621
ibuprofen (100 microg ml(-1))
ibuprofen, 2,2,4-trimethylpentane
2-(4 isobutylphenyl)propanoic acid
ACT03248
DB01050
LS-7454
ZAG-1701
( inverted question mark)-Ibuprofen
(.+-.)-p-Isobutylhydratropic acid
2-(p -isobutylphenyl)propionic acid
2-(p-isobutyl-phenyl)propionic acid
2-(p-isobutylphenyl) propionic acid
79261-49-7 (potassium salt)
ibuprofen (40mgkg(-1)day(-1))
ibuprofen-arginine-sodium bicarbonate
IDI1_000887
Tox21_110170
Tox21_201384
Tox21_302829
2-(4-i-butylphenyl) propionic acid
2-(4-iso-butylphenyl)propionic acid
2-(4-isobutyl-phenyl)propionic acid
2-(4-isobutylphenyl) propanoic acid
alpha- p-isobutylphenylpropionic acid
alpha-p- isobutylphenylpropionic acid
alpha-p-isobutylphenyl-propionic acid
ANW-21658
BBL010660
CCG-38947
DAP000780
NCGC00015529-09
NSC757073
SBB064160
2- (p-isobutylphenyl) propionic acid
2-(p -isobutylphenyl) propionic acid
2-(p-isobut-ylphenyl) propionic acid
AC-11312
CPD000058184
ibuprofen, 2-n-nonyl-1,3-dioxolane
NCI60_002065
s-2-(4-isobutylphenyl)propionic acid
SAM002264619
SMR000058184
(2-(4-isobutylphenyl)propionic acid)
(S)- (+)-p-isobutylhydratropic acid
2- (4-isobutylphenyl) propionic acid
2- (4-isobutylphenyl)-propionic acid
2-(-4-isobutylphenyl)-propionic acid
2-(4'-isobutylphenyl)-propionic acid
2-(4-iso-butylphenyl) propionic acid
2-(4-isobutyl phenyl)-propionic acid
2-(4-isobutyl-phenyl) propionic acid
2-(4-isobutyl-phenyl)-propanoic acid
2-(4-isobutylphenyl) -propionic acid
2-(4isobutyl-phenyl) -propionic acid
31121-93-4 (hydrochloride salt)
4-isobutyl-alphamethylphenylacetic acid
AKOS003237488
AKOS016340658
alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid      
Ibuprofen [USAN:USP:INN:BAN:JAN]
Tox21_110170_1
()-2-(4-isobutylphenyl) propionsaure
2- (p- isobutylphenyl) propionic acid
4-Isobutyl-.alpha.-methylphenylacetic acid
alpha-Methyl-4-(isobutyl)phenylacetic acid
CS-1931
Ibuprofen-Supplied by Selleck Chemicals
KS-5029
LP00691
MCULE-9475454445
NC00458
NSC-256857
NSC-757073
RP26239
RTR-006580
sodium a-(4-isobutylphenyl) propionate
ST-1482
TL8001184
(2-(4-isobutylphenyl)-propionic acid)
2(4-isobutylphenyl)propionate dihydrate
2- (4- isobutylphenyl) propionic acid
2-(-4-isobutyl-phenyl)-propionic acid
alpha-(4-isobutylphenyl)-propionic acid
alpha-(p-isobutylphenyl)-propionic acid
ibuprofen (75 ppm)/ce-sorb6 amidoxime
IBUPROFEN AND PSEUDOEPHEDRINE HCL
U-18,573
()-2-(4-isobutylphenyl) propionic acid
()-2-(p-isobutylphenyl) propionic acid
(~)-2-(4-isobutylphenyl)propionic acid
(R)-2-(4-Isobutylphenyl)propanoic acid
(r)-2-(4-isobutylphenyl)propionic acid
(S)-2-(4-Isobutylphenyl)propanoic acid
(S)-2-(4-Isobutylphenyl)propionic acid
(S)-4-Isobutyl-alpha-methylphenylacetic acid
.alpha.-(p-isobutylphenyl)propionic acid
2(4-isobutylphenyl)-propionate dihydrate
2-(4-isobutylphenyl)propionate dihydrate
Acide (isobutyl-4 phenyl)-2 propionique
Acide (isobutyl-4-phenyl)-2 propionique
EU-0100691
I0415
ibuprofen (150 ppm)/ce-sorb6 amidoxime
ibuprofen glucuronide, 2-hydroxyibuprofen
NCGC00015529-04
NCGC00015529-05
NCGC00015529-06
NCGC00015529-07
NCGC00015529-08
NCGC00015529-10
NCGC00015529-12
NCGC00015529-13
NCGC00015529-14
NCGC00015529-15
NCGC00015529-18
NCGC00089819-02
NCGC00089819-03
NCGC00089819-04
NCGC00089819-05
NCGC00089819-06
NCGC00089819-07
NCGC00256416-01
NCGC00258935-01
R.D. 13621
sodium a-(4- isobutylphenyl) propionate
()-2- (p-isobutylphenyl) propionic acid
(s)-2--(4-isobutylphenyl)propionic acid
.alpha.-(4-Isobutylphenyl)propionic acid
2- (4-Isobutyl- phenyl) propionic acid
AK-47272
AN-18584
BD134280
BR-47272
HY-78131
r(-)-2-(4-isobutylphenyl)propionic acid
s(+)-2-(4-isobutylphenyl)propionic acid
s(+)-2-[4-isobutylphenyl]propionic acid
ST024750
U 18573
U-18573
(+)-2-(4-isobutylphenyl) propionic acid
(+-)-2-(4-isobutylphenyl)propionic acid
(+-)-alpha-Methyl-4-(2-methylpropyl)benzeneacetic acid
[(+/-)-2-(4-Isobutylphenyl)-propionic Acid
2-(4-isobutyl phenyl)propionate dihydrate
2-(4-isobutyl-phenyl)propionate dihydrate
2-(4-isobutylphenyl)-propionate dihydrate
alpha-methyl-4-[isobutyl]phenylacetic acid
Benzeneacetic acid, .alpha.-methyl-4-(2-methylpropyl)-
C01588
D00126
I 4883
ibuprofen, 2-(4-isobutylphenyl)propanoate
sodium alpha-(4-isobutylphenyl) propionate
(+/-)-2-(4-isobutylphenyl)propionic acid
(+/-)-2-(p-isobutylphenyl)propionic acid
(R)-2-(4-isobutyl-phenyl)-propionic acid
(S)-2-(4-isobutyl-phenyl)-propionic acid
2-(4'-(2"-methylpropyl)phenyl)propionate
2-(s)-(4-isobutyl-phenyl)-propionic acid
AB1009266
alpha-methyl-4-[isobutyl]-phenylacetic acid
CAS-15687-27-1
ibuprofen (2-isobutylphenyl-propionic acid)
KB-222912
methyl-4-(2-methylpropyl)benzeneacetic acid
r(-)-2-(4-isobutylphenyl)-propionic acid
s(+)-2-(4-isobutylphenyl)-propionic acid
S-(+)-2-(4-Isobutylphenyl)propionic acid
TR-006580
(+/-)-2-(4-isobutylphenyl) propionic acid
(+/-)-2-(4-isobutylphenyl)-propionic acid
(+/-)-2-(4-Isobutylphenyl)Propanoic Acid
(+/-)-2-(p-isobutylphenyl) propionic acid
(.+-.)-2-(p-Isobutylphenyl)propionic acid
(R)- 2-(4-isobutyl-phenyl)-propionic acid
(R)-2-(4- isobutyl-phenyl)-propionic acid
(rs)-2-(4-isobutyl phenyl) propionic acid
2-[4-(2-methylpropyl)phenyl]propionic acid
AM20060782
BB 0258487
Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl)-
D007052
ibuprofen(2-(isobutylphenyl)-propionic acid)
r (-)-2-(4-isobutylphenyl)-propionic acid
(r)-(-)-2-(4-isobutylphenyl)propionic acid
(S)-(+)-2-(4-Isobutylphenyl)propionic acid
2-[4-(2-methylpropyl)phenyl] propanoic acid
Acide (isobutyl-4-phenyl)-2 propionique [French]
alpha-Methyl-4-[2-methylpropyl] benzeneacetic Acid
ibuprofen (2-(isobutylphenyl)-propionic acid)
ibuprofen, 2-(4-isobutylphenyl)propionic acid
s (+)-2-(4-isobutylphenyl) -propionic acid
(s)-(+)-2-(4-isobutylphenyl)-propionic acid
2-(4-isobutylphenyl)propanoic acid sodium salt
2-[4-(2-methylpropyl) phenyl] propanoic acid
a-methyl-4-(2-methylpropyl) benzeneacetic acid
a-methyl-4-(2-methylpropyl) benzolacetic acid
alpha methyl-4-(2-methylpropyl) benzeneacetate
alpha-methyl-4-(2-methylpropyl) benzeneacetate
I01-7039
ibuprofen (2- (isobutylphenyl)-propionic acid)
ibuprofen (2-(4-isobutylphenyl)propionic acid)
ibuprofen (2-(isobutylphenyl) -propionic acid)
ibuprofen (2-(p-isobutylphenyl)propionic acid)
ibuprofen [2-(4-isobutylphenyl)propionic acid]
M-4957
methyl-[4-(2-methylpropyl)benzene]acetic acid
a-methyl-4- (2-methylpropyl) benzeneacetic acid
a-methyl-4-(2-methylpropyl) benzene-acetic acid
AB00052020-16
AB00052020-17
alpha-methyl-4(2-methylpropyl)benzeneacetic acid
alpha-methyl-4-(2-methylpropyl)benzolacetic acid
ibuprofen (2-(4-iso-butylphenyl)propionic acid)
ibuprofen (2-(4-isobutylphenyl) propionic acid)
ibuprofen [2-(4-isobutylphenyl) propionic acid]
ibuprofen, 2-(-4-isobutylphenyl)-propionic acid
(S)-(+)-4-Isobutyl-alpha-methylphenylacetic acid
a-methyl-4- (2-methylpropyl) benzene-acetic acid
A831926
alpha-methyl-4-(2-methylpropyl) benzenacetic acid
alpha-methyl-4-(2-methylpropyl) benzolacetic acid
alpha-methyl-4-[2-methylpropyl]benzeneacetic acid
Benzeneacetic acid, ?-methyl-4-(2-methylpropyl)-
C106674
ibuprofen (2-(-4-iso-butylphenyl)propionic acid)
ibuprofen (2-(4 iso-butylphenyl) propionic acid)
ibuprofen (2-(4-iso-butylphenyl) propionic acid)
ibuprofen (2-(4-isobutyl phenyl)-propionic acid)
ibuprofen [2- (4-isobutylphenyl) propionic acid]
ibuprofen [2-(4-isobutyl-phenyl)-propionic acid]
.alpha.-Methyl-4-(2-methylpropyl)benzeneacetic acid
3B2-0156
58560-75-1
alpha-methyl-[4-(2-methylpropyl)benzene]acetic acid
alpha-methyl-4-(2-methylpropyl) benzeneacetic acid
alpha-methyl[4-(2-methylpropyl)benzene]acetic acid
l-alpha-methyl-4-(2-methylpropyl)benzeneacetic acid
s-alpha-methyl-4-(2-methylpropyl)benzeneacetic acid
(+)-a-methyl-4-(isopropylmethyl) benzeneacetic acid
(+)-alpha-methyl4-(isopropylmethyl)benzeneacetic acid
(alpha-methyl-4-(2-methylpropyl) benzeneacetic acid)
Benzeneacetic acid, alpha-methyl-4-(2-methylpropyl), (+-)-
BRD-A17655518-001-02-0
ibuprofen ((+/-)-2-(p-isobutylphenyl)propionic acid)
ibuprofen (2-4-isobutyl phenyl)propionic acid chloride
ibuprofen (4-isobutyl-alpha-methylphenyl acetic acid)
ibuprofen (alpha-methyl-4-(isobutyl)phenylacetic acid)
ibuprofen [(rs)-2-(4-isobutylphenyl)propionic acid]
ibuprofen [alpha-methyl-4-(isobutyl)phenylacetic acid]
Ibuprofin (4-isobutyl-alpha-methylphenyl acetic acid)
s-alpha-methyl-4-(2-methylpropyl)benzene-acetic acid
sodium (rs)-2-(4-isobutylphenyl)propanoate dihydrate
(+)-alpha-methyl-4-(isopropylmethyl)benzeneacetic acid
(+/-)-2-(p-isobutylphenyl) propionic acid-lysine salt
(nsaid) ibuprofen [2-(4-isobutylphenyl)propanoic acid]
3B3-005026
Ibu
ibuprofen (2-[4-(2-methylpropyl)phenyl]propanoic acid)
ibuprofen [(+/-)-2-(p-isobutylphenyl) propionic acid]
s-alpha-methyl-2-(4-[2-methylpropyl]benzene)acetic acid
ibuprofen ( -methyl-4-(2-methylpropyl)-benzeneacetic acid)
ibuprofen ( -methyl-4-(2-methylpropyl)benzene-acetic acid)
ibuprofen ( -methyl-4-(2-methylpropyl)benzeneacetic acid)
Ibuprofen (2-methyl-4-(2-methyl-propyl)benzeneacetic acid)
ibuprofen (2-methyl-4-(2methyl-propyl) benzeneacetic acid)
ibuprofen (a-methyl-4-(2-methylpropyl) benzeneacetic acid)
ibuprofen (a-methyl-4-(2-methylpropyl)-benzeneacetic acid)
ibuprofen [a-methyl-4-(2-methylpropyl)benzeneacetic acid]
ibuprofen, (s)-(+)-4isobutyl-alpha-methylphenylacetic acid
(r)-(-)-2-(4-isobutylphenyl)propionic acid [(r)-ibuprofen]
(s)-(+)-2-(4-isobutylphenyl)propionic acid [(s)-ibuprofen]
Genpril, Brufen, Nurofen, Motrin, Ibren, Ibuprohm, Ibuprofen
ibuprofen ( -methyl-4-(2-methylpropyl) benzene acetic acid)
ibuprofen ((s)(+)4-isobutyl-alpha-methylphenyl-acetic acid)
Ibuprofen (2-methyl-4- (2methyl-propyl) benzeneacetic acid)
Ibuprofen (2-methyl-4-(2-methyl-propyl) benzeneacetic acid)
ibuprofen (a-methyl-4-(2-methylpropyl) benzene-acetic acid)
ibuprofen (alpha-methyl-4-(2-methylpropyl) benzeneacetic acid)
ibuprofen (alpha-methyl-4-(2-methylpropyl)-benzeneacetic acid)
ibuprofen (alpha-methyl-4-(2-methylpropyl)benzene-acetic acid)
ibuprofen (alpha-methyl-4-(2-methylpropyl)benzeneacetic acid)
ibuprofen (alpha-methyl-4-[2-methylpropyl]phenyl acetic acid)
ibuprofen [(s)-(+)-4-isobutyl-alpha-methylphenylacetic acid]
ibuprofen [alpha-methyl-4-(2-methylpropyl)benzeneacetic acid]
ibuprofen, (s)-(+)-4-isobutyl-alpha-methylphenylacetic acid
(? inverted exclamation markA)-2-(4-Isobutylphenyl)Propanoic Acid
ibuprofen (.alpha.-methyl-4-(2-methylpropyl)-benzeneacetic acid)
ibuprofen (alpha-methyl-4-(2-methylpropyl) benzene acetic acid)
ibuprofen (ibu)-loaded poly(3-hydroxybutyrate-co-3-hydroxyvalerate)
139466-08-3
ibuprofen (alpha-methyl-4-[2-methylpropyl]-phenylacetic acid) chloride
s(-)-1-phenylethylammonium s(+)-2-(4-isobutylphenyl)propionate salt
2-deuterio-2-[2,3,5,6-tetradeuterio-4-(2-methylpropyl)phenyl]propanoic acid
|A-Methyl-4-(isobutyl)phenylacetic acid; ( inverted exclamation markA)-2-(4-Isobutylphenyl)propanoic acid; p-Isobutylhydratropic acid
141505-32-0
51146-56-6
EVE
InChI=1/C13H18O2/c1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h4-7,9-10H,8H2,1-3H3,(H,14,15)