Subject Predicate Object
http://rdf.ncbi.nlm.nih.gov/pubchem/inchikey/BSYNRYMUTXBXSQ-UHFFFAOYSA-N http://www.w3.org/1999/02/22-rdf-syntax-ns#type http://semanticscience.org/resource/CHEMINF_000399
http://rdf.ncbi.nlm.nih.gov/pubchem/inchikey/BSYNRYMUTXBXSQ-UHFFFAOYSA-N http://semanticscience.org/resource/has-value InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)
http://rdf.ncbi.nlm.nih.gov/pubchem/inchikey/BSYNRYMUTXBXSQ-UHFFFAOYSA-N http://semanticscience.org/resource/is-attribute-of http://rdf.ncbi.nlm.nih.gov/pubchem/compound/CID2244

Total number of triples: 3.