| 1 | [SID103177815] | Active | Ki | 0.0003 | Displacement of [3H]U-69593 from human recombinant Opioid receptor kappa 1 on CHO cell membranes. [AID147987, Type: Literature] | |   View X | Row No. | 1 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.0003 [uM] | | BioAssay | Displacement of [3H]U-69593 from human recombinant Opioid receptor kappa 1 on CHO cell membranes. | | AID | 147987 | | BioAssay type | Literature | | Target | | | PubMed | 12672258 | | Data Table |  |
|
| 2 | [SID103177815] | Active | Ki | 0.000475 | Binding affinity to kappa opioid receptor [AID488649, Type: Literature] | |   View X | Row No. | 2 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.000475 [uM] | | BioAssay | Binding affinity to kappa opioid receptor | | AID | 488649 | | BioAssay type | Literature | | Target | | | PubMed | 20478711 | | Data Table |  |
|
| 3 | [SID103177815] | Active | Ki | 0.00106 | Tested for inhibitory effect on binding of [3H]bremazocine to opioid receptor kappa in guinea pig cerebellum membranes [AID148101, Type: Literature] | |   View X | Row No. | 3 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.00106 [uM] | | BioAssay | Tested for inhibitory effect on binding of [3H]bremazocine to opioid receptor kappa in guinea pig cerebellum membranes | | AID | 148101 | | BioAssay type | Literature | | Target | | | PubMed | 1361580 | | Data Table |  |
|
| 4 | [SID103177815] | Active | Ki | 0.00111 | Binding affinity against opioid receptor kappa 1 from human cloned receptor [AID147998, Type: Literature] | |   View X | Row No. | 4 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.00111 [uM] | | BioAssay | Binding affinity against opioid receptor kappa 1 from human cloned receptor | | AID | 147998 | | BioAssay type | Literature | | Target | | | PubMed | 12930147 | | Data Table |  |
|
| 5 | [SID103177815] | Active | Ki | 0.00118 | Binding affinity against opioid receptor by displacing radioligand [3HlU69,593 [AID149067, Type: Literature] | |   View X | Row No. | 5 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.00118 [uM] | | BioAssay | Binding affinity against opioid receptor by displacing radioligand [3HlU69,593 | | AID | 149067 | | BioAssay type | Literature | | Target | | | PubMed | 7932569 | | Data Table |  |
|
| 6 | [SID103177815] | Active | Ki | 0.0014 | Binding constant against wild type EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells [AID148576, Type: Literature] | |   View X | Row No. | 6 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.0014 [uM] | | BioAssay | Binding constant against wild type EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells | | AID | 148576 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 7 | [SID103177815] | Active | Ki | 0.00189 | Binding affinity determined against Opioid receptor kappa 1 from a native receptor in guinea pig [AID149135, Type: Literature] | |   View X | Row No. | 7 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.00189 [uM] | | BioAssay | Binding affinity determined against Opioid receptor kappa 1 from a native receptor in guinea pig | | AID | 149135 | | BioAssay type | Literature | | Target | | | PubMed | 12930147 | | Data Table |  |
|
| 8 | [SID103177815] | Active | IC50 | 0.002 | Binding affinity towards Opioid receptor kappa 1 by the displacement of [125I]-(D-Pro10)-Dynorphin A [AID147862, Type: Literature] | |   View X | Row No. | 8 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.002 [uM] | | BioAssay | Binding affinity towards Opioid receptor kappa 1 by the displacement of [125I]-(D-Pro10)-Dynorphin A | | AID | 147862 | | BioAssay type | Literature | | Target | | | PubMed | 11755353 | | Data Table |  |
|
| 9 | [SID103177815] | Active | IC50 | 0.002 | Inhibition of [125I]-(D-Pro10)-Dynorphin A binding to human kappa opioid receptor from membranes of HEK293 cells [AID147868, Type: Literature] | |   View X | Row No. | 9 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.002 [uM] | | BioAssay | Inhibition of [125I]-(D-Pro10)-Dynorphin A binding to human kappa opioid receptor from membranes of HEK293 cells | | AID | 147868 | | BioAssay type | Literature | | Target | | | PubMed | 12643930 | | Data Table |  |
|
| 10 | [SID103177815] | Active | Ki | 0.002 | Binding affinity towards Mutant D216N, D217N, E218Q Opioid receptor kappa 1 EL-2 expressed in HEK cells [AID141256, Type: Literature] | |   View X | Row No. | 10 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.002 [uM] | | BioAssay | Binding affinity towards Mutant D216N, D217N, E218Q Opioid receptor kappa 1 EL-2 expressed in HEK cells | | AID | 141256 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 11 | [SID103177815] | Active | Ki | 0.002 | Binding constant against D216N,D217N,E218Q EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells [AID55440, Type: Literature] | |   View X | Row No. | 11 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.002 [uM] | | BioAssay | Binding constant against D216N,D217N,E218Q EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells | | AID | 55440 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 12 | [SID103177815] | Active | IC50 | 0.0021 | Inhibitory concentration against Opioid receptor kappa 1 using [3H]- U-69,593 radioligand [AID148688, Type: Literature] | |   View X | Row No. | 12 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.0021 [uM] | | BioAssay | Inhibitory concentration against Opioid receptor kappa 1 using [3H]- U-69,593 radioligand | | AID | 148688 | | BioAssay type | Literature | | Target | | | PubMed | 7853350 | | Data Table |  |
|
| 13 | [SID103177815] | Active | EC50 | 0.0022 | Effective concentration required for in vitro agonist potency in guinea-pig ileum myenteric plexus preparation (GPI) [AID73741, Type: other] | |  View X | Row No. | 13 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0022 [uM] | | BioAssay | Effective concentration required for in vitro agonist potency in guinea-pig ileum myenteric plexus preparation (GPI) | | AID | 73741 | | BioAssay type | other | | Target | | | PubMed | | | Data Table |  |
|
| 14 | [SID103177815] | Active | EC50 | 0.00225 | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux [AID302207, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 14 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.00225 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux | | AID | 302207 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 17904842 | | Data Table |  |
|
| 15 | [SID103177815] | Active | EC50 | 0.00225 | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux [AID302207, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 15 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.00225 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux | | AID | 302207 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 17904842 | | Data Table |  |
|
| 16 | [SID103177815] | Active | EC50 | 0.00225 | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux [AID302207, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 16 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.00225 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux | | AID | 302207 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 17904842 | | Data Table |  |
|
| 17 | [SID103177815] | Active | EC50 | 0.00225 | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux [AID302207, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 17 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.00225 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor assessed as inhibition of Galpha-16-induced calcium flux | | AID | 302207 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 17904842 | | Data Table |  |
|
| 18 | [SID103177815] | Active | Ki | 0.0024 | Binding constant against E203Q,D204N,D206N EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells [AID65519, Type: Literature] | |   View X | Row No. | 18 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.0024 [uM] | | BioAssay | Binding constant against E203Q,D204N,D206N EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells | | AID | 65519 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 19 | [SID103177815] | Active | Ki | 0.0024 | Binding affinity towards Mutant E203Q, D204N, D206N, Opioid receptor kappa 1 EL-2 expressed in HEK cells [AID141261, Type: Literature] | |   View X | Row No. | 19 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.0024 [uM] | | BioAssay | Binding affinity towards Mutant E203Q, D204N, D206N, Opioid receptor kappa 1 EL-2 expressed in HEK cells | | AID | 141261 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 20 | [SID103177815] | Active | Ki | 0.003 | Binding affinity towards mutant E203Q,D204N,D206N,E209Q Opioid receptor kappa 1 EL-2 expressed in HEK cells [AID141263, Type: Literature] | |   View X | Row No. | 20 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.003 [uM] | | BioAssay | Binding affinity towards mutant E203Q,D204N,D206N,E209Q Opioid receptor kappa 1 EL-2 expressed in HEK cells | | AID | 141263 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 21 | [SID103177815] | Active | Ki | 0.003 | Binding constant against E203Q,D204N,D206N,E209Q EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells [AID65522, Type: Literature] | |   View X | Row No. | 21 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.003 [uM] | | BioAssay | Binding constant against E203Q,D204N,D206N,E209Q EL-2 Opioid receptor kappa 1 using [3H]diprenorphine as radioligand expressed in HEK cells | | AID | 65522 | | BioAssay type | Literature | | Target | | | PubMed | 10753461 | | Data Table |  |
|
| 22 | [SID103177815] | Active | Kd | 0.0043 | Binding affinity at Opioid receptor kappa 1 in guinea pig brain membrane determined by using [3H]U-69593 as radioligand [AID148826, Type: Literature] | |   View X | Row No. | 22 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Kd | 0.0043 [uM] | | BioAssay | Binding affinity at Opioid receptor kappa 1 in guinea pig brain membrane determined by using [3H]U-69593 as radioligand | | AID | 148826 | | BioAssay type | Literature | | Target | | | PubMed | 2845084 | | Data Table |  |
|
| 23 | [SID103177815] | Active | Ki | 0.0048 | Binding affinity at Opioid receptor kappa 1 by displacement of [3H]U-69593 in guinea pig brain membranes [AID149124, Type: Literature] | |   View X | Row No. | 23 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.0048 [uM] | | BioAssay | Binding affinity at Opioid receptor kappa 1 by displacement of [3H]U-69593 in guinea pig brain membranes | | AID | 149124 | | BioAssay type | Literature | | Target | | | PubMed | 14998329 | | Data Table |  |
|
| 24 | [SID103177815] | Active | EC50 | 0.0066 | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay [AID378998, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 24 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0066 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay | | AID | 378998 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16441078 | | Data Table |  |
|
| 25 | [SID103177815] | Active | EC50 | 0.0066 | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay [AID378998, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 25 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0066 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay | | AID | 378998 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16441078 | | Data Table |  |
|
| 26 | [SID103177815] | Active | EC50 | 0.0066 | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay [AID378998, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 26 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0066 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay | | AID | 378998 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16441078 | | Data Table |  |
|
| 27 | [SID103177815] | Active | EC50 | 0.0066 | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay [AID378998, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 27 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0066 [uM] | | BioAssay | Agonist activity at human kappa opioid receptor-Galpha-16 fusion protein expressed in CHO cells by calcium flux assay | | AID | 378998 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16441078 | | Data Table |  |
|
| 28 | [SID103177815] | Active | Ki | 0.0073 | Binding affinity for the Opioid receptor kappa 1 [AID149131, Type: Literature] | |   View X | Row No. | 28 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.0073 [uM] | | BioAssay | Binding affinity for the Opioid receptor kappa 1 | | AID | 149131 | | BioAssay type | Literature | | Target | | | PubMed | 2832603 | | Data Table |  |
|
| 29 | [SID103177815] | Active | IC50 | 0.008 | Displacement of [3H]naloxone from kappa opioid receptor expressed in HEK293 cell membrane [AID480391, Type: Literature] | |   View X | Row No. | 29 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.008 [uM] | | BioAssay | Displacement of [3H]naloxone from kappa opioid receptor expressed in HEK293 cell membrane | | AID | 480391 | | BioAssay type | Literature | | Target | | | PubMed | 20426456 | | Data Table |  |
|
| 30 | [SID103177815] | Active | ED50 | 0.024 | Effective dose for agonistic activity towards human kappa opioid receptor from membranes of HEK293 cells was determined by radiolabeled [35S]GTP-gamma-S, assay [AID147846, Type: Literature] | |   View X | Row No. | 30 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | ED50 | 0.024 [uM] | | BioAssay | Effective dose for agonistic activity towards human kappa opioid receptor from membranes of HEK293 cells was determined by radiolabeled [35S]GTP-gamma-S, assay | | AID | 147846 | | BioAssay type | Literature | | Target | | | PubMed | 12643930 | | Data Table |  |
|
| 31 | [SID103177815] | Active | EC50 | 0.028 | Effective concentration required for in vitro evaluation of agonist activity on mouse vas deferens preparation [AID127786, Type: other] | |  View X | Row No. | 31 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.028 [uM] | | BioAssay | Effective concentration required for in vitro evaluation of agonist activity on mouse vas deferens preparation | | AID | 127786 | | BioAssay type | other | | Target | | | PubMed | | | Data Table |  |
|
| 32 | [SID103177815] | Active | Ki | 0.052 | Binding affinity for the Opioid receptor mu 1 [AID147910, Type: Literature] | |   View X | Row No. | 32 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.052 [uM] | | BioAssay | Binding affinity for the Opioid receptor mu 1 | | AID | 147910 | | BioAssay type | Literature | | Target | | | PubMed | 2832603 | | Data Table |  |
|
| 33 | [SID103177815] | Active | EC50 | 0.0643 | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane [AID268069, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 33 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0643 [uM] | | BioAssay | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane | | AID | 268069 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16650985 | | Data Table |  |
|
| 34 | [SID103177815] | Active | EC50 | 0.0643 | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane [AID268069, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 34 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0643 [uM] | | BioAssay | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane | | AID | 268069 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16650985 | | Data Table |  |
|
| 35 | [SID103177815] | Active | EC50 | 0.0643 | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane [AID268069, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 35 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0643 [uM] | | BioAssay | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane | | AID | 268069 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16650985 | | Data Table |  |
|
| 36 | [SID103177815] | Active | EC50 | 0.0643 | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane [AID268069, Type: Literature] | Kappa-type opioid receptor [gi:116242691] |   View X | Row No. | 36 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | EC50 | 0.0643 [uM] | | BioAssay | Stimulation of [35S]GTP-gamma-S binding at kappa opioid receptor in human brain cortical membrane | | AID | 268069 | | BioAssay type | Literature | | Target | Kappa-type opioid receptor [gi:116242691] | | PubMed | 16650985 | | Data Table |  |
|
| 37 | [SID103177815] | Active | IC50 | 0.139 | Inhibitory concentration was determined against Opioid receptors using [3H]- bremazocine radioligand [AID150239, Type: Literature] | |   View X | Row No. | 37 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.139 [uM] | | BioAssay | Inhibitory concentration was determined against Opioid receptors using [3H]- bremazocine radioligand | | AID | 150239 | | BioAssay type | Literature | | Target | | | PubMed | 7853350 | | Data Table |  |
|
| 38 | [SID103177815] | Active | IC50 | 0.14 | Tested for inhibitory concentration against [3H]bremazocine binding to total sites of opioid receptor in guinea pig brain membrane [AID148620, Type: Literature] | |   View X | Row No. | 38 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.14 [uM] | | BioAssay | Tested for inhibitory concentration against [3H]bremazocine binding to total sites of opioid receptor in guinea pig brain membrane | | AID | 148620 | | BioAssay type | Literature | | Target | | | PubMed | 8071934 | | Data Table |  |
|
| 39 | [SID103177815] | Active | IC50 | 0.248 | Binding affinity towards Opioid receptor mu 1 by the displacement of [125I]Enkephalin; Not determined [AID148357, Type: Literature] | |   View X | Row No. | 39 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.248 [uM] | | BioAssay | Binding affinity towards Opioid receptor mu 1 by the displacement of [125I]Enkephalin; Not determined | | AID | 148357 | | BioAssay type | Literature | | Target | | | PubMed | 11755353 | | Data Table |  |
|
| 40 | [SID103177815] | Active | IC50 | 0.25 | Inhibition of [125I]Enkephalin binding to human mu opioid receptor from membranes of HEK293 cells [AID150825, Type: Literature] | |   View X | Row No. | 40 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 0.25 [uM] | | BioAssay | Inhibition of [125I]Enkephalin binding to human mu opioid receptor from membranes of HEK293 cells | | AID | 150825 | | BioAssay type | Literature | | Target | | | PubMed | 12643930 | | Data Table |  |
|
| 41 | [SID103177815] | Active | Ki | 0.551 | Tested for inhibitory effect on binding of [3H]DAMGO to opioid receptor mu in guinea pig cerebellum membranes [AID149019, Type: Literature] | |   View X | Row No. | 41 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 0.551 [uM] | | BioAssay | Tested for inhibitory effect on binding of [3H]DAMGO to opioid receptor mu in guinea pig cerebellum membranes | | AID | 149019 | | BioAssay type | Literature | | Target | | | PubMed | 1361580 | | Data Table |  |
|
| 42 | [SID103177815] | Active | ED50 | 0.684 | Ability to stimulate binding to mu-opioid receptor using GTP-gamma -S-binding assay in guinea pig caudate membranes under unblocked condition [AID152215, Type: Literature] | |   View X | Row No. | 42 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | ED50 | 0.684 [uM] | | BioAssay | Ability to stimulate binding to mu-opioid receptor using GTP-gamma -S-binding assay in guinea pig caudate membranes under unblocked condition | | AID | 152215 | | BioAssay type | Literature | | Target | | | PubMed | 11300879 | | Data Table |  |
|
| 43 | [SID103177815] | Active | Kd | 0.684 | Binding affinity against Mu opioid receptor using [35S]GTP-gamma-S, binding assay in guinea pig caudate membranes in unblocked condition [AID138706, Type: Literature] | |   View X | Row No. | 43 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Kd | 0.684 [uM] | | BioAssay | Binding affinity against Mu opioid receptor using [35S]GTP-gamma-S, binding assay in guinea pig caudate membranes in unblocked condition | | AID | 138706 | | BioAssay type | Literature | | Target | | | PubMed | 10571174 | | Data Table |  |
|
| 44 | [SID103177815] | Active | Kd | 0.684 | Binding affinity against Mu opioid receptor using [35S]GTP-gamma-S, binding assay in guinea pig caudate membranes in unblocked condition [AID141497, Type: Literature] | |   View X | Row No. | 44 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Kd | 0.684 [uM] | | BioAssay | Binding affinity against Mu opioid receptor using [35S]GTP-gamma-S, binding assay in guinea pig caudate membranes in unblocked condition | | AID | 141497 | | BioAssay type | Literature | | Target | | | PubMed | 10612597 | | Data Table |  |
|
| 45 | [SID103177815] | Active | Ki | 1.099 | Displacement of radiolabeled NalBzOH from kappa3 opioid receptor in Hartley guinea pig brain [AID268680, Type: Literature] | |   View X | Row No. | 45 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 1.099 [uM] | | BioAssay | Displacement of radiolabeled NalBzOH from kappa3 opioid receptor in Hartley guinea pig brain | | AID | 268680 | | BioAssay type | Literature | | Target | | | PubMed | 16777416 | | Data Table |  |
|
| 46 | [SID103177815] | Active | Ki | 1.145 | Displacement of [3H]DAMGO from human recombinant Opioid receptor mu 1 on CHO cell membranes. [AID150841, Type: Literature] | |   View X | Row No. | 46 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 1.145 [uM] | | BioAssay | Displacement of [3H]DAMGO from human recombinant Opioid receptor mu 1 on CHO cell membranes. | | AID | 150841 | | BioAssay type | Literature | | Target | | | PubMed | 12672258 | | Data Table |  |
|
| 47 | [SID103177815] | Active | Ki | 1.358 | Displacement of radiolabeled DPDPE-Cl from delta opioid receptor in Hartley guinea pig brain [AID268678, Type: Literature] | |   View X | Row No. | 47 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 1.358 [uM] | | BioAssay | Displacement of radiolabeled DPDPE-Cl from delta opioid receptor in Hartley guinea pig brain | | AID | 268678 | | BioAssay type | Literature | | Target | | | PubMed | 16777416 | | Data Table |  |
|
| 48 | [SID103177815] | Active | IC50 | 1.76 | Inhibitory concentration was determined against Opioid receptor mu 1 using [3H]- DAMGO radioligand [AID149863, Type: Literature] | |   View X | Row No. | 48 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | IC50 | 1.76 [uM] | | BioAssay | Inhibitory concentration was determined against Opioid receptor mu 1 using [3H]- DAMGO radioligand | | AID | 149863 | | BioAssay type | Literature | | Target | | | PubMed | 7853350 | | Data Table |  |
|
| 49 | [SID103177815] | Active | Ki | 1.88 | Binding affinity of compound was determined against Opioid receptor mu 1 from native receptor in guinea pig [AID147914, Type: Literature] | |   View X | Row No. | 49 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Ki | 1.88 [uM] | | BioAssay | Binding affinity of compound was determined against Opioid receptor mu 1 from native receptor in guinea pig | | AID | 147914 | | BioAssay type | Literature | | Target | | | PubMed | 12930147 | | Data Table |  |
|
| 50 | [SID103177815] | Active | Kd | 1.98 | Binding affinity against Delta opioid receptor in using [35S]GTP-gamma-S, binding assay in guinea pig caudate membranes blocked with 20 nM NTI [AID56281, Type: Literature] | |   View X | Row No. | 50 | | Structure |
| | Substance | | | SID | 103177815 | | CID | 105104 | | Outcome | Active | | Kd | 1.98 [uM] | | BioAssay | Binding affinity against Delta opioid receptor in using [35S]GTP-gamma-S, binding assay in guinea pig caudate membranes blocked with 20 nM NTI | | AID | 56281 | | BioAssay type | Literature | | Target | | | PubMed | 10571174 | | Data Table |  |
|